About [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol
[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol (PubChem CID 10236452) has the molecular formula C13H14F2N4O2
and a molecular weight of 296.28 g/mol. Its IUPAC name is [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol |
| PubChem CID | 10236452 |
| Molecular Formula | C13H14F2N4O2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2cc(F)c(N3CCOCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C13H14F2N4O2/c14-11-5-10(19-7-9(8-20)16-17-19)6-12(15)13(11)18-1-3-21-4-2-18/h5-7,20H,1-4,8H2 |
| InChIKey | IUDQQILZTPPQTC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol?
The IUPAC name of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol (CID 10236452) is [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol.
What is the SMILES notation for [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol?
The canonical SMILES for [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol is OCc1cn(-c2cc(F)c(N3CCOCC3)c(F)c2)nn1.
What is the InChIKey of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol?
The InChIKey is IUDQQILZTPPQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N4O2/c14-11-5-10(19-7-9(8-20)16-17-19)6-12(15)13(11)18-1-3-21-4-2-18/h5-7,20H,1-4,8H2.
What are the key properties of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol?
[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol has a molecular weight of 296.28 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol is sourced from PubChem (CID 10236452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).