C13H14F2N4O2 — CID 10236452
[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol (PubChem CID 10236452) has the molecular formula C13H14F2N4O2 and a molecular weight of 296.28 g/mol. Its IUPAC name is [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol.
| Compound Name | [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 10236452 |
| Molecular Formula | C13H14F2N4O2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2cc(F)c(N3CCOCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C13H14F2N4O2/c14-11-5-10(19-7-9(8-20)16-17-19)6-12(15)13(11)18-1-3-21-4-2-18/h5-7,20H,1-4,8H2 |
| InChIKey | IUDQQILZTPPQTC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|