C15H11F2N7OS — CID 58758304
O-methyl N-[[1-[3,5-difluoro-4-(4-isocyanoimidazol-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 58758304) has the molecular formula C15H11F2N7OS and a molecular weight of 375.36 g/mol. Its IUPAC name is O-methyl N-[[1-[3,5-difluoro-4-(4-isocyanoimidazol-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[3,5-difluoro-4-(4-isocyanoimidazol-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 58758304 |
| Molecular Formula | C15H11F2N7OS |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | O-methyl N-[[1-[3,5-difluoro-4-(4-isocyanoimidazol-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | [C-]#[N+]c1cn(-c2c(F)cc(-n3cc(CNC(=S)OC)nn3)cc2F)cn1 |
| InChI | InChI=1S/C15H11F2N7OS/c1-18-13-7-23(8-20-13)14-11(16)3-10(4-12(14)17)24-6-9(21-22-24)5-19-15(26)25-2/h3-4,6-8H,5H2,2H3,(H,19,26) |
| InChIKey | DYCYQQIEVBWDMA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|