C16H13FN6OS — CID 87912854
O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 87912854) has the molecular formula C16H13FN6OS and a molecular weight of 356.39 g/mol. Its IUPAC name is O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 87912854 |
| Molecular Formula | C16H13FN6OS |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2ccc(-n3ccc(C#N)c3)c(F)c2)nn1 |
| InChI | InChI=1S/C16H13FN6OS/c1-24-16(25)19-8-12-10-23(21-20-12)13-2-3-15(14(17)6-13)22-5-4-11(7-18)9-22/h2-6,9-10H,8H2,1H3,(H,19,25) |
| InChIKey | VRGOAEXDPYKRMX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|