About O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate
O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 87912854) has the molecular formula C16H13FN6OS
and a molecular weight of 356.39 g/mol. Its IUPAC name is O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate.
Molecular Properties
| Compound Name | O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
| PubChem CID | 87912854 |
| Molecular Formula | C16H13FN6OS |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2ccc(-n3ccc(C#N)c3)c(F)c2)nn1 |
| InChI | InChI=1S/C16H13FN6OS/c1-24-16(25)19-8-12-10-23(21-20-12)13-2-3-15(14(17)6-13)22-5-4-11(7-18)9-22/h2-6,9-10H,8H2,1H3,(H,19,25) |
| InChIKey | VRGOAEXDPYKRMX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate?
The IUPAC name of O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate (CID 87912854) is O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate.
What is the SMILES notation for O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate?
The canonical SMILES for O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate is COC(=S)NCc1cn(-c2ccc(-n3ccc(C#N)c3)c(F)c2)nn1.
What is the InChIKey of O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate?
The InChIKey is VRGOAEXDPYKRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN6OS/c1-24-16(25)19-8-12-10-23(21-20-12)13-2-3-15(14(17)6-13)22-5-4-11(7-18)9-22/h2-6,9-10H,8H2,1H3,(H,19,25).
What are the key properties of O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate?
O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate has a molecular weight of 356.39 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-[[1-[4-(3-cyanopyrrol-1-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate is sourced from PubChem (CID 87912854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).