C15H19FN6OS2 — CID 91255717
O-methyl N-[[1-[4-(1-amino-1λ4-thia-4-azacyclohex-6-en-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 91255717) has the molecular formula C15H19FN6OS2 and a molecular weight of 382.49 g/mol. Its IUPAC name is O-methyl N-[[1-[4-(1-amino-1λ4-thia-4-azacyclohex-6-en-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[4-(1-amino-1λ4-thia-4-azacyclohex-6-en-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 91255717 |
| Molecular Formula | C15H19FN6OS2 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | O-methyl N-[[1-[4-(1-amino-1λ4-thia-4-azacyclohex-6-en-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2ccc(N3CC=S(N)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C15H19FN6OS2/c1-23-15(24)18-9-11-10-22(20-19-11)12-2-3-14(13(16)8-12)21-4-6-25(17)7-5-21/h2-3,6,8,10H,4-5,7,9,17H2,1H3,(H,18,24) |
| InChIKey | YGNCEWSKORYJJY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|