C16H17FN4OS2 — CID 11360524
O-methyl N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 11360524) has the molecular formula C16H17FN4OS2 and a molecular weight of 364.47 g/mol. Its IUPAC name is O-methyl N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 11360524 |
| Molecular Formula | C16H17FN4OS2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | O-methyl N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2ccc(C3=CCSCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C16H17FN4OS2/c1-22-16(23)18-9-12-10-21(20-19-12)13-2-3-14(15(17)8-13)11-4-6-24-7-5-11/h2-4,8,10H,5-7,9H2,1H3,(H,18,23) |
| InChIKey | QXPXKAXBZXXJRQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|