C17H18FN5O2S — CID 143096357
[1-[4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]triazol-4-yl]methylcarbamothioic S-acid (PubChem CID 143096357) has the molecular formula C17H18FN5O2S and a molecular weight of 375.43 g/mol. Its IUPAC name is [1-[4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]triazol-4-yl]methylcarbamothioic S-acid.
| Compound Name | [1-[4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]triazol-4-yl]methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 143096357 |
| Molecular Formula | C17H18FN5O2S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [1-[4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]triazol-4-yl]methylcarbamothioic S-acid |
| SMILES | CC(=O)N1CC=C(c2ccc(-n3cc(CNC(=O)S)nn3)cc2F)CC1 |
| InChI | InChI=1S/C17H18FN5O2S/c1-11(24)22-6-4-12(5-7-22)15-3-2-14(8-16(15)18)23-10-13(20-21-23)9-19-17(25)26/h2-4,8,10H,5-7,9H2,1H3,(H2,19,25,26) |
| InChIKey | YOAIRTQYXLBKBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|