C13H13F2N7O2S — CID 10150341
4-[4-[4-(azidomethyl)triazol-1-yl]-2,6-difluorophenyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 10150341) has the molecular formula C13H13F2N7O2S and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-[4-[4-(azidomethyl)triazol-1-yl]-2,6-difluorophenyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[4-[4-(azidomethyl)triazol-1-yl]-2,6-difluorophenyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 10150341 |
| Molecular Formula | C13H13F2N7O2S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-[4-[4-(azidomethyl)triazol-1-yl]-2,6-difluorophenyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | [N-]=[N+]=NCc1cn(-c2cc(F)c(N3CCS(=O)(=O)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C13H13F2N7O2S/c14-11-5-10(22-8-9(18-20-22)7-17-19-16)6-12(15)13(11)21-1-3-25(23,24)4-2-21/h5-6,8H,1-4,7H2 |
| InChIKey | MHVFXXDTFRUNNS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 116.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|