C10H12N6S — CID 178054642
1-amino-3-[(1-phenyltriazol-4-yl)methyl]thiourea (PubChem CID 178054642) has the molecular formula C10H12N6S and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-amino-3-[(1-phenyltriazol-4-yl)methyl]thiourea.
| Compound Name | 1-amino-3-[(1-phenyltriazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 178054642 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-amino-3-[(1-phenyltriazol-4-yl)methyl]thiourea |
| SMILES | NNC(=S)NCc1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C10H12N6S/c11-13-10(17)12-6-8-7-16(15-14-8)9-4-2-1-3-5-9/h1-5,7H,6,11H2,(H2,12,13,17) |
| InChIKey | TZQVEMKUMZTZNO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|