C19H20FNO — CID 67065996
1-benzyl-4-(2-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine (PubChem CID 67065996) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-benzyl-4-(2-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-(2-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 67065996 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-benzyl-4-(2-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine |
| SMILES | COc1ccc(C2=CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H20FNO/c1-22-17-7-8-18(19(20)13-17)16-9-11-21(12-10-16)14-15-5-3-2-4-6-15/h2-9,13H,10-12,14H2,1H3 |
| InChIKey | ANPYVGCYOCPBKJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |