C20H22BrNO2 — CID 66652851
1-benzyl-4-[(2-bromo-5-methoxyphenoxy)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 66652851) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 1-benzyl-4-[(2-bromo-5-methoxyphenoxy)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-[(2-bromo-5-methoxyphenoxy)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 66652851 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-benzyl-4-[(2-bromo-5-methoxyphenoxy)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | COc1ccc(Br)c(OCC2=CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H22BrNO2/c1-23-18-7-8-19(21)20(13-18)24-15-17-9-11-22(12-10-17)14-16-5-3-2-4-6-16/h2-9,13H,10-12,14-15H2,1H3 |
| InChIKey | CHNOTURFSDWQII-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|