C20H21BrFNO — CID 164933785
1-benzyl-4-[(6-bromo-2-fluoro-3-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 164933785) has the molecular formula C20H21BrFNO and a molecular weight of 390.30 g/mol. Its IUPAC name is 1-benzyl-4-[(6-bromo-2-fluoro-3-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-[(6-bromo-2-fluoro-3-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 164933785 |
| Molecular Formula | C20H21BrFNO |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 1-benzyl-4-[(6-bromo-2-fluoro-3-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccc(Br)c(OCC2=CCN(Cc3ccccc3)CC2)c1F |
| InChI | InChI=1S/C20H21BrFNO/c1-15-7-8-18(21)20(19(15)22)24-14-17-9-11-23(12-10-17)13-16-5-3-2-4-6-16/h2-9H,10-14H2,1H3 |
| InChIKey | ZNLFHMVAXVLDRY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|