C23H24BrNO5 — CID 169103687
dimethyl 3-[(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)methoxy]-4-bromobenzene-1,2-dicarboxylate (PubChem CID 169103687) has the molecular formula C23H24BrNO5 and a molecular weight of 474.35 g/mol. Its IUPAC name is dimethyl 3-[(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)methoxy]-4-bromobenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)methoxy]-4-bromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169103687 |
| Molecular Formula | C23H24BrNO5 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | dimethyl 3-[(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)methoxy]-4-bromobenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(Br)c(OCC2=CCN(Cc3ccccc3)CC2)c1C(=O)OC |
| InChI | InChI=1S/C23H24BrNO5/c1-28-22(26)18-8-9-19(24)21(20(18)23(27)29-2)30-15-17-10-12-25(13-11-17)14-16-6-4-3-5-7-16/h3-10H,11-15H2,1-2H3 |
| InChIKey | MUEACHGHGIJCFH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|