C15H16BrNO4 — CID 170727955
methyl 4-bromo-2-formyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethoxy)benzoate (PubChem CID 170727955) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is methyl 4-bromo-2-formyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethoxy)benzoate.
| Compound Name | methyl 4-bromo-2-formyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 170727955 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | methyl 4-bromo-2-formyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethoxy)benzoate |
| SMILES | COC(=O)c1ccc(Br)c(OCC2=CCNCC2)c1C=O |
| InChI | InChI=1S/C15H16BrNO4/c1-20-15(19)11-2-3-13(16)14(12(11)8-18)21-9-10-4-6-17-7-5-10/h2-4,8,17H,5-7,9H2,1H3 |
| InChIKey | SOUOYZWXQDUDDC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|