C17H18BrNO4 — CID 100712300
methyl 4-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-prop-2-enylbenzoate (PubChem CID 100712300) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is methyl 4-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-prop-2-enylbenzoate.
| Compound Name | methyl 4-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 100712300 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | methyl 4-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-prop-2-enylbenzoate |
| SMILES | C=CCc1c(C(=O)OC)ccc(Br)c1OCc1c(C)noc1C |
| InChI | InChI=1S/C17H18BrNO4/c1-5-6-12-13(17(20)21-4)7-8-15(18)16(12)22-9-14-10(2)19-23-11(14)3/h5,7-8H,1,6,9H2,2-4H3 |
| InChIKey | HZIQIDFUZDBIJJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|