C8H15N3O4S — CID 114694270
methyl N-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)carbamate (PubChem CID 114694270) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is methyl N-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)carbamate.
| Compound Name | methyl N-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114694270 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl N-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)carbamate |
| SMILES | COC(=O)NS(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C8H15N3O4S/c1-15-8(12)11-16(13,14)10-6-7-2-4-9-5-3-7/h2,9-10H,3-6H2,1H3,(H,11,12) |
| InChIKey | AAGSGDJJIYPODN-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|