C21H24BrNO — CID 177120343
1-benzyl-4-[(2-bromo-3,4-dimethylphenoxy)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 177120343) has the molecular formula C21H24BrNO and a molecular weight of 386.33 g/mol. Its IUPAC name is 1-benzyl-4-[(2-bromo-3,4-dimethylphenoxy)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-[(2-bromo-3,4-dimethylphenoxy)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 177120343 |
| Molecular Formula | C21H24BrNO |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-benzyl-4-[(2-bromo-3,4-dimethylphenoxy)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccc(OCC2=CCN(Cc3ccccc3)CC2)c(Br)c1C |
| InChI | InChI=1S/C21H24BrNO/c1-16-8-9-20(21(22)17(16)2)24-15-19-10-12-23(13-11-19)14-18-6-4-3-5-7-18/h3-10H,11-15H2,1-2H3 |
| InChIKey | YZZTUTUXXUYJMU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|