C20H22FNO — CID 139679454
1-benzyl-5-[(4-fluoro-2-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 139679454) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-benzyl-5-[(4-fluoro-2-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-5-[(4-fluoro-2-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 139679454 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-benzyl-5-[(4-fluoro-2-methylphenoxy)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | Cc1cc(F)ccc1OCC1=CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H22FNO/c1-16-12-19(21)9-10-20(16)23-15-18-8-5-11-22(14-18)13-17-6-3-2-4-7-17/h2-4,6-10,12H,5,11,13-15H2,1H3 |
| InChIKey | GOAFSIUBZHBURH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|