C17H25N3 — CID 117206009
1-[(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)methyl]piperazine (PubChem CID 117206009) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-[(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)methyl]piperazine.
| Compound Name | 1-[(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 117206009 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-[(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)methyl]piperazine |
| SMILES | C1=C(CN2CCNCC2)CN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3/c1-2-5-16(6-3-1)13-20-10-4-7-17(15-20)14-19-11-8-18-9-12-19/h1-3,5-7,18H,4,8-15H2 |
| InChIKey | BWFKYVTYJGDMJR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|