C13H16FN — CID 117205582
1-benzyl-5-(fluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 117205582) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-benzyl-5-(fluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-5-(fluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 117205582 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-benzyl-5-(fluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | FCC1=CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H16FN/c14-9-13-7-4-8-15(11-13)10-12-5-2-1-3-6-12/h1-3,5-7H,4,8-11H2 |
| InChIKey | NJJNVTFYUFZATQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|