C18H18FN — CID 19095580
1-benzyl-5-(3-fluorophenyl)-3,6-dihydro-2H-pyridine (PubChem CID 19095580) has the molecular formula C18H18FN and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-benzyl-5-(3-fluorophenyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-5-(3-fluorophenyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 19095580 |
| Molecular Formula | C18H18FN |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-benzyl-5-(3-fluorophenyl)-3,6-dihydro-2H-pyridine |
| SMILES | Fc1cccc(C2=CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C18H18FN/c19-18-10-4-8-16(12-18)17-9-5-11-20(14-17)13-15-6-2-1-3-7-15/h1-4,6-10,12H,5,11,13-14H2 |
| InChIKey | YPKNSIZOYBNSTB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |