C20H20FN — CID 171973239
8-benzyl-3-(3-fluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 171973239) has the molecular formula C20H20FN and a molecular weight of 293.39 g/mol. Its IUPAC name is 8-benzyl-3-(3-fluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-benzyl-3-(3-fluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 171973239 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 8-benzyl-3-(3-fluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | Fc1cccc(C2=CC3CCC(C2)N3Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H20FN/c21-18-8-4-7-16(11-18)17-12-19-9-10-20(13-17)22(19)14-15-5-2-1-3-6-15/h1-8,11-12,19-20H,9-10,13-14H2 |
| InChIKey | PVQMDPIRDINMTI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |