C22H24I3NO — CID 123525033
8-benzyl-3-(3-methoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene;iodoform (PubChem CID 123525033) has the molecular formula C22H24I3NO and a molecular weight of 699.15 g/mol. Its IUPAC name is 8-benzyl-3-(3-methoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene;iodoform.
| Compound Name | 8-benzyl-3-(3-methoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene;iodoform |
|---|---|
| PubChem CID | 123525033 |
| Molecular Formula | C22H24I3NO |
| Molecular Weight | 699.15 g/mol |
| Exact Mass | 698.90 |
| IUPAC Name | 8-benzyl-3-(3-methoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene;iodoform |
| SMILES | COc1cccc(C2=CC3CCC(C2)N3Cc2ccccc2)c1.IC(I)I |
| InChI | InChI=1S/C21H23NO.CHI3/c1-23-21-9-5-8-17(14-21)18-12-19-10-11-20(13-18)22(19)15-16-6-3-2-4-7-16;2-1(3)4/h2-9,12,14,19-20H,10-11,13,15H2,1H3;1H |
| InChIKey | IDDQTMVFEZAULO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.15 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|