C22H22F3NO — CID 171969114
8-benzyl-3-[4-methoxy-3-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 171969114) has the molecular formula C22H22F3NO and a molecular weight of 373.42 g/mol. Its IUPAC name is 8-benzyl-3-[4-methoxy-3-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-benzyl-3-[4-methoxy-3-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 171969114 |
| Molecular Formula | C22H22F3NO |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 8-benzyl-3-[4-methoxy-3-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | COc1ccc(C2=CC3CCC(C2)N3Cc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H22F3NO/c1-27-21-10-7-16(13-20(21)22(23,24)25)17-11-18-8-9-19(12-17)26(18)14-15-5-3-2-4-6-15/h2-7,10-11,13,18-19H,8-9,12,14H2,1H3 |
| InChIKey | MALTYIXFGRVQOX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |