C23H24NO5- — CID 20502636
3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)phenol;(E)-4-methoxy-4-oxobut-2-enoate (PubChem CID 20502636) has the molecular formula C23H24NO5- and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)phenol;(E)-4-methoxy-4-oxobut-2-enoate.
| Compound Name | 3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)phenol;(E)-4-methoxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 20502636 |
| Molecular Formula | C23H24NO5- |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)phenol;(E)-4-methoxy-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)[O-].Oc1cccc(C2=CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C18H19NO.C5H6O4/c20-18-10-4-8-16(12-18)17-9-5-11-19(14-17)13-15-6-2-1-3-7-15;1-9-5(8)3-2-4(6)7/h1-4,6-10,12,20H,5,11,13-14H2;2-3H,1H3,(H,6,7)/p-1/b;3-2+ |
| InChIKey | OCJKXNXOUQSPOP-ZPYUXNTASA-M |
| XLogP | 2.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|