C21H22N2O — CID 168941512
3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-7-methoxy-1H-indole (PubChem CID 168941512) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-7-methoxy-1H-indole.
| Compound Name | 3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-7-methoxy-1H-indole |
|---|---|
| PubChem CID | 168941512 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-7-methoxy-1H-indole |
| SMILES | COc1cccc2c(C3=CCCN(Cc4ccccc4)C3)c[nH]c12 |
| InChI | InChI=1S/C21H22N2O/c1-24-20-11-5-10-18-19(13-22-21(18)20)17-9-6-12-23(15-17)14-16-7-3-2-4-8-16/h2-5,7-11,13,22H,6,12,14-15H2,1H3 |
| InChIKey | CPUXTBGUBNKLOH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |