C23H23Br2NO2 — CID 118131425
4-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-3-(1-bromoethyl)isochromen-1-one;hydrobromide (PubChem CID 118131425) has the molecular formula C23H23Br2NO2 and a molecular weight of 505.25 g/mol. Its IUPAC name is 4-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-3-(1-bromoethyl)isochromen-1-one;hydrobromide.
| Compound Name | 4-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-3-(1-bromoethyl)isochromen-1-one;hydrobromide |
|---|---|
| PubChem CID | 118131425 |
| Molecular Formula | C23H23Br2NO2 |
| Molecular Weight | 505.25 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 4-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-3-(1-bromoethyl)isochromen-1-one;hydrobromide |
| SMILES | Br.CC(Br)c1oc(=O)c2ccccc2c1C1=CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H22BrNO2.BrH/c1-16(24)22-21(19-11-5-6-12-20(19)23(26)27-22)18-10-7-13-25(15-18)14-17-8-3-2-4-9-17;/h2-6,8-12,16H,7,13-15H2,1H3;1H |
| InChIKey | AEHLDBXSKCAPTF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.25 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|