C29H32N2O3 — CID 11059524
1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-5,6-dimethoxyindol-1-yl]-3,3-dimethylpent-4-yn-1-one (PubChem CID 11059524) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-5,6-dimethoxyindol-1-yl]-3,3-dimethylpent-4-yn-1-one.
| Compound Name | 1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-5,6-dimethoxyindol-1-yl]-3,3-dimethylpent-4-yn-1-one |
|---|---|
| PubChem CID | 11059524 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-5-yl)-5,6-dimethoxyindol-1-yl]-3,3-dimethylpent-4-yn-1-one |
| SMILES | C#CC(C)(C)CC(=O)n1cc(C2=CCCN(Cc3ccccc3)C2)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C29H32N2O3/c1-6-29(2,3)17-28(32)31-20-24(23-15-26(33-4)27(34-5)16-25(23)31)22-13-10-14-30(19-22)18-21-11-8-7-9-12-21/h1,7-9,11-13,15-16,20H,10,14,17-19H2,2-5H3 |
| InChIKey | VTAXZALFSRFUHC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|