C25H26N2O — CID 10525433
1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]pent-4-en-1-one (PubChem CID 10525433) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]pent-4-en-1-one.
| Compound Name | 1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 10525433 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)n1cc(C2=CCN(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H26N2O/c1-2-3-13-25(28)27-19-23(22-11-7-8-12-24(22)27)21-14-16-26(17-15-21)18-20-9-5-4-6-10-20/h2,4-12,14,19H,1,3,13,15-18H2 |
| InChIKey | LRYLWLOZUYHOCN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|