C16H17NS — CID 59628497
1-benzyl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 59628497) has the molecular formula C16H17NS and a molecular weight of 255.39 g/mol. Its IUPAC name is 1-benzyl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 59628497 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-benzyl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | C1=C(c2cccs2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H17NS/c1-2-5-14(6-3-1)13-17-10-8-15(9-11-17)16-7-4-12-18-16/h1-8,12H,9-11,13H2 |
| InChIKey | HEXUBIGXEBPECI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |