C14H14N2S — CID 2824517
2-benzyl-5-thiophen-2-yl-3,4-dihydropyrazole (PubChem CID 2824517) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-benzyl-5-thiophen-2-yl-3,4-dihydropyrazole.
| Compound Name | 2-benzyl-5-thiophen-2-yl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 2824517 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-benzyl-5-thiophen-2-yl-3,4-dihydropyrazole |
| SMILES | c1ccc(CN2CCC(c3cccs3)=N2)cc1 |
| InChI | InChI=1S/C14H14N2S/c1-2-5-12(6-3-1)11-16-9-8-13(15-16)14-7-4-10-17-14/h1-7,10H,8-9,11H2 |
| InChIKey | QPFGDKBRFDTDQD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |