C9H11N3S2 — CID 46946468
N-methyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 46946468) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is N-methyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-methyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 46946468 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | N-methyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CNC(=S)N1CCC(c2cccs2)=N1 |
| InChI | InChI=1S/C9H11N3S2/c1-10-9(13)12-5-4-7(11-12)8-3-2-6-14-8/h2-3,6H,4-5H2,1H3,(H,10,13) |
| InChIKey | OVBACGOFPLUVSM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|