C21H21N2S+ — CID 11317560
1,3-dibenzyl-2-thiophen-2-yl-4,5-dihydroimidazol-1-ium (PubChem CID 11317560) has the molecular formula C21H21N2S+ and a molecular weight of 333.48 g/mol. Its IUPAC name is 1,3-dibenzyl-2-thiophen-2-yl-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-dibenzyl-2-thiophen-2-yl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 11317560 |
| Molecular Formula | C21H21N2S+ |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1,3-dibenzyl-2-thiophen-2-yl-4,5-dihydroimidazol-1-ium |
| SMILES | c1ccc(CN2CC[N+](Cc3ccccc3)=C2c2cccs2)cc1 |
| InChI | InChI=1S/C21H21N2S/c1-3-8-18(9-4-1)16-22-13-14-23(17-19-10-5-2-6-11-19)21(22)20-12-7-15-24-20/h1-12,15H,13-14,16-17H2/q+1 |
| InChIKey | GBSOGCXMRICXDE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|