C23H18F5N2+ — CID 11307530
1,3-dibenzyl-2-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydroimidazol-1-ium (PubChem CID 11307530) has the molecular formula C23H18F5N2+ and a molecular weight of 417.40 g/mol. Its IUPAC name is 1,3-dibenzyl-2-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-dibenzyl-2-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 11307530 |
| Molecular Formula | C23H18F5N2+ |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1,3-dibenzyl-2-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydroimidazol-1-ium |
| SMILES | Fc1c(F)c(F)c(C2=[N+](Cc3ccccc3)CCN2Cc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C23H18F5N2/c24-18-17(19(25)21(27)22(28)20(18)26)23-29(13-15-7-3-1-4-8-15)11-12-30(23)14-16-9-5-2-6-10-16/h1-10H,11-14H2/q+1 |
| InChIKey | KYEMITIJYJBZPE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|