C18H20N2 — CID 86006012
1-benzyl-2-(2-phenylethyl)-4,5-dihydroimidazole (PubChem CID 86006012) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-benzyl-2-(2-phenylethyl)-4,5-dihydroimidazole.
| Compound Name | 1-benzyl-2-(2-phenylethyl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 86006012 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-benzyl-2-(2-phenylethyl)-4,5-dihydroimidazole |
| SMILES | c1ccc(CCC2=NCCN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N2/c1-3-7-16(8-4-1)11-12-18-19-13-14-20(18)15-17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | CSMXKHAYHXVPTD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |