C16H16N2O3S — CID 11445528
2-(1-benzyl-4,5-dihydroimidazol-2-yl)benzenesulfonic acid (PubChem CID 11445528) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-(1-benzyl-4,5-dihydroimidazol-2-yl)benzenesulfonic acid.
| Compound Name | 2-(1-benzyl-4,5-dihydroimidazol-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 11445528 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(1-benzyl-4,5-dihydroimidazol-2-yl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1C1=NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O3S/c19-22(20,21)15-9-5-4-8-14(15)16-17-10-11-18(16)12-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,19,20,21) |
| InChIKey | CBJPVEKMHRAQNF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|