C15H19N3O3 — CID 132776206
ethyl 3-amino-2-(1-benzyl-4,5-dihydroimidazol-2-yl)-3-oxopropanoate (PubChem CID 132776206) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 3-amino-2-(1-benzyl-4,5-dihydroimidazol-2-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-amino-2-(1-benzyl-4,5-dihydroimidazol-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 132776206 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | ethyl 3-amino-2-(1-benzyl-4,5-dihydroimidazol-2-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(N)=O)C1=NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C15H19N3O3/c1-2-21-15(20)12(13(16)19)14-17-8-9-18(14)10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H2,16,19) |
| InChIKey | GEEDBORDDPWOGS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|