C14H17NO4 — CID 123926319
ethyl 1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylate (PubChem CID 123926319) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 123926319 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(O)CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C14H17NO4/c1-2-19-13(17)14(18)8-9-15(12(14)16)10-11-6-4-3-5-7-11/h3-7,18H,2,8-10H2,1H3 |
| InChIKey | QZFBZLMYBOKCMM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|