C12H13NO4 — CID 118570434
(3S)-1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 118570434) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (3S)-1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118570434 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (3S)-1-benzyl-3-hydroxy-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C12H13NO4/c14-10-12(17,11(15)16)6-7-13(10)8-9-4-2-1-3-5-9/h1-5,17H,6-8H2,(H,15,16)/t12-/m0/s1 |
| InChIKey | CSMDNBDZQXEEJL-LBPRGKRZSA-N |
| XLogP | 0.23 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|