C27H28N2O2 — CID 11971389
1,4-dibenzyl-6-ethyl-6-phenyl-1,4-diazepane-5,7-dione (PubChem CID 11971389) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1,4-dibenzyl-6-ethyl-6-phenyl-1,4-diazepane-5,7-dione.
| Compound Name | 1,4-dibenzyl-6-ethyl-6-phenyl-1,4-diazepane-5,7-dione |
|---|---|
| PubChem CID | 11971389 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1,4-dibenzyl-6-ethyl-6-phenyl-1,4-diazepane-5,7-dione |
| SMILES | CCC1(c2ccccc2)C(=O)N(Cc2ccccc2)CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H28N2O2/c1-2-27(24-16-10-5-11-17-24)25(30)28(20-22-12-6-3-7-13-22)18-19-29(26(27)31)21-23-14-8-4-9-15-23/h3-17H,2,18-21H2,1H3 |
| InChIKey | YJIYTQJSJQCEFS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|