C10H12ClN3 — CID 68917390
3-[[2-(chloromethyl)-4,5-dihydroimidazol-1-yl]methyl]pyridine (PubChem CID 68917390) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 3-[[2-(chloromethyl)-4,5-dihydroimidazol-1-yl]methyl]pyridine.
| Compound Name | 3-[[2-(chloromethyl)-4,5-dihydroimidazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 68917390 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 3-[[2-(chloromethyl)-4,5-dihydroimidazol-1-yl]methyl]pyridine |
| SMILES | ClCC1=NCCN1Cc1cccnc1 |
| InChI | InChI=1S/C10H12ClN3/c11-6-10-13-4-5-14(10)8-9-2-1-3-12-7-9/h1-3,7H,4-6,8H2 |
| InChIKey | JLJFSVQORGMXQZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|