C11H14N2O2 — CID 117013986
4-hydroxy-1-(pyridin-3-ylmethyl)piperidin-2-one (PubChem CID 117013986) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-hydroxy-1-(pyridin-3-ylmethyl)piperidin-2-one.
| Compound Name | 4-hydroxy-1-(pyridin-3-ylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 117013986 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-hydroxy-1-(pyridin-3-ylmethyl)piperidin-2-one |
| SMILES | O=C1CC(O)CCN1Cc1cccnc1 |
| InChI | InChI=1S/C11H14N2O2/c14-10-3-5-13(11(15)6-10)8-9-2-1-4-12-7-9/h1-2,4,7,10,14H,3,5-6,8H2 |
| InChIKey | IOKSHIWBQIWGMM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |