C23H27N3O3 — CID 131915998
4-(4-phenylmethoxypiperidine-1-carbonyl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one (PubChem CID 131915998) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-(4-phenylmethoxypiperidine-1-carbonyl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one.
| Compound Name | 4-(4-phenylmethoxypiperidine-1-carbonyl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 131915998 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-(4-phenylmethoxypiperidine-1-carbonyl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCC(OCc3ccccc3)CC2)CN1Cc1cccnc1 |
| InChI | InChI=1S/C23H27N3O3/c27-22-13-20(16-26(22)15-19-7-4-10-24-14-19)23(28)25-11-8-21(9-12-25)29-17-18-5-2-1-3-6-18/h1-7,10,14,20-21H,8-9,11-13,15-17H2 |
| InChIKey | MNXIZDGWLCHUHM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |