C21H24N4O3 — CID 98324872
(4R)-4-[4-(4-hydroxyphenyl)piperazine-1-carbonyl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one (PubChem CID 98324872) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is (4R)-4-[4-(4-hydroxyphenyl)piperazine-1-carbonyl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-[4-(4-hydroxyphenyl)piperazine-1-carbonyl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 98324872 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (4R)-4-[4-(4-hydroxyphenyl)piperazine-1-carbonyl]-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1C[C@@H](C(=O)N2CCN(c3ccc(O)cc3)CC2)CN1Cc1cccnc1 |
| InChI | InChI=1S/C21H24N4O3/c26-19-5-3-18(4-6-19)23-8-10-24(11-9-23)21(28)17-12-20(27)25(15-17)14-16-2-1-7-22-13-16/h1-7,13,17,26H,8-12,14-15H2/t17-/m1/s1 |
| InChIKey | KNFOMMTXSJZDMG-QGZVFWFLSA-N |
| XLogP | 1.48 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |