C23H28N4O4S — CID 26742799
N-[4-[[(4aS,9aR)-6-oxo-7-(pyridin-3-ylmethyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-2-yl]sulfonyl]phenyl]acetamide (PubChem CID 26742799) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[4-[[(4aS,9aR)-6-oxo-7-(pyridin-3-ylmethyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-2-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[(4aS,9aR)-6-oxo-7-(pyridin-3-ylmethyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-2-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 26742799 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[4-[[(4aS,9aR)-6-oxo-7-(pyridin-3-ylmethyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-2-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC[C@H]3CC(=O)N(Cc4cccnc4)CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C23H28N4O4S/c1-17(28)25-21-4-6-22(7-5-21)32(30,31)27-12-9-19-13-23(29)26(11-8-20(19)16-27)15-18-3-2-10-24-14-18/h2-7,10,14,19-20H,8-9,11-13,15-16H2,1H3,(H,25,28)/t19-,20-/m0/s1 |
| InChIKey | DYUZQUPYIBQOJW-PMACEKPBSA-N |
| XLogP | 2.49 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |