C23H22BrClN2 — CID 11212882
1,3-dibenzyl-2-(2-chlorophenyl)-4,5-dihydroimidazol-1-ium bromide (PubChem CID 11212882) has the molecular formula C23H22BrClN2 and a molecular weight of 441.80 g/mol. Its IUPAC name is 1,3-dibenzyl-2-(2-chlorophenyl)-4,5-dihydroimidazol-1-ium bromide.
| Compound Name | 1,3-dibenzyl-2-(2-chlorophenyl)-4,5-dihydroimidazol-1-ium bromide |
|---|---|
| PubChem CID | 11212882 |
| Molecular Formula | C23H22BrClN2 |
| Molecular Weight | 441.80 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1,3-dibenzyl-2-(2-chlorophenyl)-4,5-dihydroimidazol-1-ium bromide |
| SMILES | Clc1ccccc1C1=[N+](Cc2ccccc2)CCN1Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C23H22ClN2.BrH/c24-22-14-8-7-13-21(22)23-25(17-19-9-3-1-4-10-19)15-16-26(23)18-20-11-5-2-6-12-20;/h1-14H,15-18H2;1H/q+1;/p-1 |
| InChIKey | BEHIAMSBZSXKCK-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|