C34H36BrN4+ — CID 54607307
1,3-dibenzyl-2-(1,3-dibenzyl-4,5-dihydroimidazol-1-ium-2-yl)-4,5-dihydroimidazol-1-ium bromide (PubChem CID 54607307) has the molecular formula C34H36BrN4+ and a molecular weight of 580.59 g/mol. Its IUPAC name is 1,3-dibenzyl-2-(1,3-dibenzyl-4,5-dihydroimidazol-1-ium-2-yl)-4,5-dihydroimidazol-1-ium bromide.
| Compound Name | 1,3-dibenzyl-2-(1,3-dibenzyl-4,5-dihydroimidazol-1-ium-2-yl)-4,5-dihydroimidazol-1-ium bromide |
|---|---|
| PubChem CID | 54607307 |
| Molecular Formula | C34H36BrN4+ |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 1,3-dibenzyl-2-(1,3-dibenzyl-4,5-dihydroimidazol-1-ium-2-yl)-4,5-dihydroimidazol-1-ium bromide |
| SMILES | [Br-].c1ccc(CN2CC[N+](Cc3ccccc3)=C2C2=[N+](Cc3ccccc3)CCN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N4.BrH/c1-5-13-29(14-6-1)25-35-21-22-36(26-30-15-7-2-8-16-30)33(35)34-37(27-31-17-9-3-10-18-31)23-24-38(34)28-32-19-11-4-12-20-32;/h1-20H,21-28H2;1H/q+2;/p-1 |
| InChIKey | BJWYAKAFLNMYPF-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|