C11H15N2+ — CID 22044317
1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium (PubChem CID 22044317) has the molecular formula C11H15N2+ and a molecular weight of 175.25 g/mol. Its IUPAC name is 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium.
| Compound Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 22044317 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium |
| SMILES | C[N+]1=CN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C11H15N2/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/q+1 |
| InChIKey | LLIHLTPXLWDBGT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|