About 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium
1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium (PubChem CID 22044317) has the molecular formula C11H15N2+
and a molecular weight of 175.25 g/mol. Its IUPAC name is 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium.
Molecular Properties
| Compound Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium |
| PubChem CID | 22044317 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium |
| SMILES | C[N+]1=CN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C11H15N2/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/q+1 |
| InChIKey | LLIHLTPXLWDBGT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium?
The IUPAC name of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium (CID 22044317) is 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium.
What is the SMILES notation for 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium?
The canonical SMILES for 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium is C[N+]1=CN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium?
The InChIKey is LLIHLTPXLWDBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/q+1.
What are the key properties of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium?
1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium has a molecular weight of 175.25 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium is sourced from PubChem (CID 22044317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).