C13H15NO — CID 91446287
1-benzyl-5-methyl-2,4-dihydropyridin-3-one (PubChem CID 91446287) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-benzyl-5-methyl-2,4-dihydropyridin-3-one.
| Compound Name | 1-benzyl-5-methyl-2,4-dihydropyridin-3-one |
|---|---|
| PubChem CID | 91446287 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-benzyl-5-methyl-2,4-dihydropyridin-3-one |
| SMILES | CC1=CN(Cc2ccccc2)CC(=O)C1 |
| InChI | InChI=1S/C13H15NO/c1-11-7-13(15)10-14(8-11)9-12-5-3-2-4-6-12/h2-6,8H,7,9-10H2,1H3 |
| InChIKey | LCGRCQCATJDGHX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |