C14H17N — CID 152701817
1-benzyl-3,5-dimethyl-2H-pyridine (PubChem CID 152701817) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-benzyl-3,5-dimethyl-2H-pyridine.
| Compound Name | 1-benzyl-3,5-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 152701817 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-benzyl-3,5-dimethyl-2H-pyridine |
| SMILES | CC1=CN(Cc2ccccc2)CC(C)=C1 |
| InChI | InChI=1S/C14H17N/c1-12-8-13(2)10-15(9-12)11-14-6-4-3-5-7-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | ZRSWWOFKJGRVPQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |