C15H21N — CID 142383024
1-benzyl-2,5-dimethylpyrrole;ethane (PubChem CID 142383024) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-benzyl-2,5-dimethylpyrrole;ethane.
| Compound Name | 1-benzyl-2,5-dimethylpyrrole;ethane |
|---|---|
| PubChem CID | 142383024 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-benzyl-2,5-dimethylpyrrole;ethane |
| SMILES | CC.Cc1ccc(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C13H15N.C2H6/c1-11-8-9-12(2)14(11)10-13-6-4-3-5-7-13;1-2/h3-9H,10H2,1-2H3;1-2H3 |
| InChIKey | WVMFGSONTYRFNS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_N(1)', 'substructure': 'N/A'} |
|---|